C13H16N2O — CID 176933500
4-ethyl-N,N-dimethyl-1H-indole-2-carboxamide (PubChem CID 176933500) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-ethyl-N,N-dimethyl-1H-indole-2-carboxamide.
| Compound Name | 4-ethyl-N,N-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 176933500 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-ethyl-N,N-dimethyl-1H-indole-2-carboxamide |
| SMILES | CCc1cccc2[nH]c(C(=O)N(C)C)cc12 |
| InChI | InChI=1S/C13H16N2O/c1-4-9-6-5-7-11-10(9)8-12(14-11)13(16)15(2)3/h5-8,14H,4H2,1-3H3 |
| InChIKey | KCHUHKQLXFQQDO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |