C19H18BrFN2O — CID 55596607
N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 55596607) has the molecular formula C19H18BrFN2O and a molecular weight of 389.27 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 55596607 |
| Molecular Formula | C19H18BrFN2O |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)N(C)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C19H18BrFN2O/c1-12-16(15-5-3-4-6-18(15)22-12)10-19(24)23(2)11-13-9-14(20)7-8-17(13)21/h3-9,22H,10-11H2,1-2H3 |
| InChIKey | ZSGVWTSSBMHNFA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|