C10H11BrF2 — CID 152963520
1-(bromomethyl)-2,4-difluoro-5-propan-2-ylbenzene (PubChem CID 152963520) has the molecular formula C10H11BrF2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 1-(bromomethyl)-2,4-difluoro-5-propan-2-ylbenzene.
| Compound Name | 1-(bromomethyl)-2,4-difluoro-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 152963520 |
| Molecular Formula | C10H11BrF2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1-(bromomethyl)-2,4-difluoro-5-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(CBr)c(F)cc1F |
| InChI | InChI=1S/C10H11BrF2/c1-6(2)8-3-7(5-11)9(12)4-10(8)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | URBAXLULZIYFED-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|