C9H9BrF2 — CID 148681980
1-(bromomethyl)-5-ethyl-2,4-difluorobenzene (PubChem CID 148681980) has the molecular formula C9H9BrF2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 1-(bromomethyl)-5-ethyl-2,4-difluorobenzene.
| Compound Name | 1-(bromomethyl)-5-ethyl-2,4-difluorobenzene |
|---|---|
| PubChem CID | 148681980 |
| Molecular Formula | C9H9BrF2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 1-(bromomethyl)-5-ethyl-2,4-difluorobenzene |
| SMILES | CCc1cc(CBr)c(F)cc1F |
| InChI | InChI=1S/C9H9BrF2/c1-2-6-3-7(5-10)9(12)4-8(6)11/h3-4H,2,5H2,1H3 |
| InChIKey | NRUHQVXRPIDJGB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|