2-(5-ethyl-2,4-difluorophenyl)acetic acid

C10H10F2O2 — CID 117289054

IUPAC2-(5-ethyl-2,4-difluorophenyl)acetic acid
SMILESCCc1cc(CC(=O)O)c(F)cc1F
InChIInChI=1S/C10H10F2O2/c1-2-6-3-7(4-10(13)14)9(12)5-8(6)11/h3,5H,2,4H2,1H3,(H,13,14)
InChIKeyQKUOXWBSGBEEJJ-UHFFFAOYSA-N
MW200.18 g/mol
LogP2.15
Rot. Bonds3

About 2-(5-ethyl-2,4-difluorophenyl)acetic acid

2-(5-ethyl-2,4-difluorophenyl)acetic acid (PubChem CID 117289054) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 2-(5-ethyl-2,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-(5-ethyl-2,4-difluorophenyl)acetic acid
PubChem CID117289054
Molecular FormulaC10H10F2O2
Molecular Weight200.18 g/mol
Exact Mass200.06
IUPAC Name2-(5-ethyl-2,4-difluorophenyl)acetic acid
SMILESCCc1cc(CC(=O)O)c(F)cc1F
InChIInChI=1S/C10H10F2O2/c1-2-6-3-7(4-10(13)14)9(12)5-8(6)11/h3,5H,2,4H2,1H3,(H,13,14)
InChIKeyQKUOXWBSGBEEJJ-UHFFFAOYSA-N
XLogP2.15
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.18
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(5-ethyl-2,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-ethyl-2,4-difluorophenyl)acetic acid?
The IUPAC name of 2-(5-ethyl-2,4-difluorophenyl)acetic acid (CID 117289054) is 2-(5-ethyl-2,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2-(5-ethyl-2,4-difluorophenyl)acetic acid?
The canonical SMILES for 2-(5-ethyl-2,4-difluorophenyl)acetic acid is CCc1cc(CC(=O)O)c(F)cc1F.
What is the InChIKey of 2-(5-ethyl-2,4-difluorophenyl)acetic acid?
The InChIKey is QKUOXWBSGBEEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O2/c1-2-6-3-7(4-10(13)14)9(12)5-8(6)11/h3,5H,2,4H2,1H3,(H,13,14).
What are the key properties of 2-(5-ethyl-2,4-difluorophenyl)acetic acid?
2-(5-ethyl-2,4-difluorophenyl)acetic acid has a molecular weight of 200.18 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-2,4-difluorophenyl)acetic acid is sourced from PubChem (CID 117289054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).