C10H8F4O2 — CID 66523493
2-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]acetic acid (PubChem CID 66523493) has the molecular formula C10H8F4O2 and a molecular weight of 236.16 g/mol. Its IUPAC name is 2-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 66523493 |
| Molecular Formula | C10H8F4O2 |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]acetic acid |
| SMILES | Cc1cc(CC(=O)O)c(F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H8F4O2/c1-5-2-6(3-9(15)16)8(11)4-7(5)10(12,13)14/h2,4H,3H2,1H3,(H,15,16) |
| InChIKey | SCCXDMHIISSUCO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |