C26H19BrF4 — CID 158814146
1-(bromomethyl)-2,4-difluoro-5-phenylbenzene;1,5-difluoro-2-methyl-4-phenylbenzene (PubChem CID 158814146) has the molecular formula C26H19BrF4 and a molecular weight of 487.33 g/mol. Its IUPAC name is 1-(bromomethyl)-2,4-difluoro-5-phenylbenzene;1,5-difluoro-2-methyl-4-phenylbenzene.
| Compound Name | 1-(bromomethyl)-2,4-difluoro-5-phenylbenzene;1,5-difluoro-2-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 158814146 |
| Molecular Formula | C26H19BrF4 |
| Molecular Weight | 487.33 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 1-(bromomethyl)-2,4-difluoro-5-phenylbenzene;1,5-difluoro-2-methyl-4-phenylbenzene |
| SMILES | Cc1cc(-c2ccccc2)c(F)cc1F.Fc1cc(F)c(-c2ccccc2)cc1CBr |
| InChI | InChI=1S/C13H9BrF2.C13H10F2/c14-8-10-6-11(13(16)7-12(10)15)9-4-2-1-3-5-9;1-9-7-11(13(15)8-12(9)14)10-5-3-2-4-6-10/h1-7H,8H2;2-8H,1H3 |
| InChIKey | IVBCHPSQTRYNPS-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.33 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|