C17H19Cl2N — CID 63523051
2-[(3,4-dichlorophenyl)methyl]-2-phenylbutan-1-amine (PubChem CID 63523051) has the molecular formula C17H19Cl2N and a molecular weight of 308.25 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]-2-phenylbutan-1-amine.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]-2-phenylbutan-1-amine |
|---|---|
| PubChem CID | 63523051 |
| Molecular Formula | C17H19Cl2N |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]-2-phenylbutan-1-amine |
| SMILES | CCC(CN)(Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C17H19Cl2N/c1-2-17(12-20,14-6-4-3-5-7-14)11-13-8-9-15(18)16(19)10-13/h3-10H,2,11-12,20H2,1H3 |
| InChIKey | CQFZUIQGUYWWIM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |