C11H9Cl2NO3S — CID 1478967
4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione (PubChem CID 1478967) has the molecular formula C11H9Cl2NO3S and a molecular weight of 306.17 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione |
|---|---|
| PubChem CID | 1478967 |
| Molecular Formula | C11H9Cl2NO3S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione |
| SMILES | O=C1CS(=O)CC(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2NO3S/c12-8-2-1-7(3-9(8)13)4-14-10(15)5-18(17)6-11(14)16/h1-3H,4-6H2 |
| InChIKey | BHAWJOHZTFCGTE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|