About 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione
4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione (PubChem CID 1478967) has the molecular formula C11H9Cl2NO3S
and a molecular weight of 306.17 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione.
Molecular Properties
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione |
| PubChem CID | 1478967 |
| Molecular Formula | C11H9Cl2NO3S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione |
| SMILES | O=C1CS(=O)CC(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2NO3S/c12-8-2-1-7(3-9(8)13)4-14-10(15)5-18(17)6-11(14)16/h1-3H,4-6H2 |
| InChIKey | BHAWJOHZTFCGTE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione?
The IUPAC name of 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione (CID 1478967) is 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione.
What is the SMILES notation for 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione?
The canonical SMILES for 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione is O=C1CS(=O)CC(=O)N1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione?
The InChIKey is BHAWJOHZTFCGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2NO3S/c12-8-2-1-7(3-9(8)13)4-14-10(15)5-18(17)6-11(14)16/h1-3H,4-6H2.
What are the key properties of 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione?
4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione has a molecular weight of 306.17 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dichlorophenyl)methyl]-1-oxo-1,4-thiazinane-3,5-dione is sourced from PubChem (CID 1478967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).