C12H13Cl2NO2 — CID 64617121
2-[1-[(3,4-dichlorophenyl)methyl]azetidin-3-yl]acetic acid (PubChem CID 64617121) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 2-[1-[(3,4-dichlorophenyl)methyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(3,4-dichlorophenyl)methyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64617121 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-[1-[(3,4-dichlorophenyl)methyl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H13Cl2NO2/c13-10-2-1-8(3-11(10)14)5-15-6-9(7-15)4-12(16)17/h1-3,9H,4-7H2,(H,16,17) |
| InChIKey | OGUNWSQRGXIDLI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |