C11H11Cl2NO4S — CID 64618221
2-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]acetic acid (PubChem CID 64618221) has the molecular formula C11H11Cl2NO4S and a molecular weight of 324.19 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]acetic acid.
| Compound Name | 2-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64618221 |
| Molecular Formula | C11H11Cl2NO4S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H11Cl2NO4S/c12-9-2-1-8(4-10(9)13)19(17,18)14-5-7(6-14)3-11(15)16/h1-2,4,7H,3,5-6H2,(H,15,16) |
| InChIKey | TWMBWYYPNCIJGN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |