C11H11FN2O6S — CID 82846592
2-[1-(3-fluoro-4-nitrophenyl)sulfonylazetidin-3-yl]acetic acid (PubChem CID 82846592) has the molecular formula C11H11FN2O6S and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-[1-(3-fluoro-4-nitrophenyl)sulfonylazetidin-3-yl]acetic acid.
| Compound Name | 2-[1-(3-fluoro-4-nitrophenyl)sulfonylazetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 82846592 |
| Molecular Formula | C11H11FN2O6S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-[1-(3-fluoro-4-nitrophenyl)sulfonylazetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(S(=O)(=O)c2ccc([N+](=O)[O-])c(F)c2)C1 |
| InChI | InChI=1S/C11H11FN2O6S/c12-9-4-8(1-2-10(9)14(17)18)21(19,20)13-5-7(6-13)3-11(15)16/h1-2,4,7H,3,5-6H2,(H,15,16) |
| InChIKey | YJCDDGQKCKSIRI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|