C12H14BrCl2NO2S — CID 80676262
3-(bromomethyl)-1-(3,4-dichlorophenyl)sulfonylpiperidine (PubChem CID 80676262) has the molecular formula C12H14BrCl2NO2S and a molecular weight of 387.13 g/mol. Its IUPAC name is 3-(bromomethyl)-1-(3,4-dichlorophenyl)sulfonylpiperidine.
| Compound Name | 3-(bromomethyl)-1-(3,4-dichlorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 80676262 |
| Molecular Formula | C12H14BrCl2NO2S |
| Molecular Weight | 387.13 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 3-(bromomethyl)-1-(3,4-dichlorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCCC(CBr)C1 |
| InChI | InChI=1S/C12H14BrCl2NO2S/c13-7-9-2-1-5-16(8-9)19(17,18)10-3-4-11(14)12(15)6-10/h3-4,6,9H,1-2,5,7-8H2 |
| InChIKey | XYYLYLBTEYERTI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.13 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|