C23H15Cl2NO2 — CID 141451883
1-[(3,4-dichlorophenyl)methyl]-3,4-diphenylpyrrole-2,5-dione (PubChem CID 141451883) has the molecular formula C23H15Cl2NO2 and a molecular weight of 408.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3,4-diphenylpyrrole-2,5-dione.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3,4-diphenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 141451883 |
| Molecular Formula | C23H15Cl2NO2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3,4-diphenylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H15Cl2NO2/c24-18-12-11-15(13-19(18)25)14-26-22(27)20(16-7-3-1-4-8-16)21(23(26)28)17-9-5-2-6-10-17/h1-13H,14H2 |
| InChIKey | DRFCDRQNOVKKHX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|