C23H13Cl2F2NO2 — CID 139593935
1-benzyl-3,4-bis(3-chloro-4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 139593935) has the molecular formula C23H13Cl2F2NO2 and a molecular weight of 444.26 g/mol. Its IUPAC name is 1-benzyl-3,4-bis(3-chloro-4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3,4-bis(3-chloro-4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139593935 |
| Molecular Formula | C23H13Cl2F2NO2 |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 1-benzyl-3,4-bis(3-chloro-4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)c(Cl)c2)=C(c2ccc(F)c(Cl)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H13Cl2F2NO2/c24-16-10-14(6-8-18(16)26)20-21(15-7-9-19(27)17(25)11-15)23(30)28(22(20)29)12-13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | PCQYJLDIYMPRPU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|