C17H12Cl2N2O — CID 8698921
2-[(3,4-dichlorophenyl)methyl]-6-phenylpyridazin-3-one (PubChem CID 8698921) has the molecular formula C17H12Cl2N2O and a molecular weight of 331.20 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]-6-phenylpyridazin-3-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]-6-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 8698921 |
| Molecular Formula | C17H12Cl2N2O |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]-6-phenylpyridazin-3-one |
| SMILES | O=c1ccc(-c2ccccc2)nn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N2O/c18-14-7-6-12(10-15(14)19)11-21-17(22)9-8-16(20-21)13-4-2-1-3-5-13/h1-10H,11H2 |
| InChIKey | RFWBWUCJAGTXHK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |