About 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one
2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one (PubChem CID 7672212) has the molecular formula C20H20N2O
and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one |
| PubChem CID | 7672212 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one |
| SMILES | Cc1cc(C)c(-c2ccc(=O)n(Cc3ccccc3)n2)cc1C |
| InChI | InChI=1S/C20H20N2O/c1-14-11-16(3)18(12-15(14)2)19-9-10-20(23)22(21-19)13-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3 |
| InChIKey | SYSYGZLTZHXBBS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one?
The IUPAC name of 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one (CID 7672212) is 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one.
What is the SMILES notation for 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one?
The canonical SMILES for 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one is Cc1cc(C)c(-c2ccc(=O)n(Cc3ccccc3)n2)cc1C.
What is the InChIKey of 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one?
The InChIKey is SYSYGZLTZHXBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O/c1-14-11-16(3)18(12-15(14)2)19-9-10-20(23)22(21-19)13-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3.
What are the key properties of 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one?
2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one has a molecular weight of 304.39 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-6-(2,4,5-trimethylphenyl)pyridazin-3-one is sourced from PubChem (CID 7672212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).