C18H11Cl3N2O3 — CID 55884026
(2,4,6-trichlorophenyl) 2-(6-oxo-3-phenylpyridazin-1-yl)acetate (PubChem CID 55884026) has the molecular formula C18H11Cl3N2O3 and a molecular weight of 409.66 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 2-(6-oxo-3-phenylpyridazin-1-yl)acetate.
| Compound Name | (2,4,6-trichlorophenyl) 2-(6-oxo-3-phenylpyridazin-1-yl)acetate |
|---|---|
| PubChem CID | 55884026 |
| Molecular Formula | C18H11Cl3N2O3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | (2,4,6-trichlorophenyl) 2-(6-oxo-3-phenylpyridazin-1-yl)acetate |
| SMILES | O=C(Cn1nc(-c2ccccc2)ccc1=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Cl3N2O3/c19-12-8-13(20)18(14(21)9-12)26-17(25)10-23-16(24)7-6-15(22-23)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | TTZPOWKOVAVZMP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|