C24H18ClN3O2 — CID 3224557
2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(2-phenylphenyl)acetamide (PubChem CID 3224557) has the molecular formula C24H18ClN3O2 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 3224557 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(2-phenylphenyl)acetamide |
| SMILES | O=C(Cn1nc(-c2ccc(Cl)cc2)ccc1=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H18ClN3O2/c25-19-12-10-18(11-13-19)21-14-15-24(30)28(27-21)16-23(29)26-22-9-5-4-8-20(22)17-6-2-1-3-7-17/h1-15H,16H2,(H,26,29) |
| InChIKey | HDBUWRNWULJKBO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |