C21H18ClN3O4 — CID 95196545
(2R)-2-[[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 95196545) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is (2R)-2-[[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 95196545 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2R)-2-[[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(Cn1nc(-c2ccc(Cl)cc2)ccc1=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H18ClN3O4/c22-16-8-6-15(7-9-16)17-10-11-20(27)25(24-17)13-19(26)23-18(21(28)29)12-14-4-2-1-3-5-14/h1-11,18H,12-13H2,(H,23,26)(H,28,29)/t18-/m1/s1 |
| InChIKey | RMHUWWNLULOPLZ-GOSISDBHSA-N |
| XLogP | 2.38 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |