C24H18Cl2N2O3 — CID 110594252
3-(3-chloro-4-methoxyanilino)-1-[(4-chlorophenyl)methyl]-4-phenylpyrrole-2,5-dione (PubChem CID 110594252) has the molecular formula C24H18Cl2N2O3 and a molecular weight of 453.33 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)-1-[(4-chlorophenyl)methyl]-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyanilino)-1-[(4-chlorophenyl)methyl]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110594252 |
| Molecular Formula | C24H18Cl2N2O3 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)-1-[(4-chlorophenyl)methyl]-4-phenylpyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(c3ccccc3)C(=O)N(Cc3ccc(Cl)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C24H18Cl2N2O3/c1-31-20-12-11-18(13-19(20)26)27-22-21(16-5-3-2-4-6-16)23(29)28(24(22)30)14-15-7-9-17(25)10-8-15/h2-13,27H,14H2,1H3 |
| InChIKey | HKOGIEAXPBFQMB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|