C15H17ClN5O2+ — CID 78208112
7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione (PubChem CID 78208112) has the molecular formula C15H17ClN5O2+ and a molecular weight of 334.79 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78208112 |
| Molecular Formula | C15H17ClN5O2+ |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione |
| SMILES | CNC1=[N+](Cc2ccc(Cl)cc2)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C15H16ClN5O2/c1-17-14-18-12-11(13(22)20(3)15(23)19(12)2)21(14)8-9-4-6-10(16)7-5-9/h4-7,11H,8H2,1-3H3/p+1 |
| InChIKey | HPKXAFNWHOKDLH-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|