C18H16ClN6O2S+ — CID 78214876
7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-pyrimidin-2-ylsulfanyl-5H-purin-7-ium-2,6-dione (PubChem CID 78214876) has the molecular formula C18H16ClN6O2S+ and a molecular weight of 415.89 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-pyrimidin-2-ylsulfanyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-pyrimidin-2-ylsulfanyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78214876 |
| Molecular Formula | C18H16ClN6O2S+ |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-pyrimidin-2-ylsulfanyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(Sc3ncccn3)=[N+]2Cc2ccc(Cl)cc2)N(C)C1=O |
| InChI | InChI=1S/C18H16ClN6O2S/c1-23-14-13(15(26)24(2)18(23)27)25(10-11-4-6-12(19)7-5-11)17(22-14)28-16-20-8-3-9-21-16/h3-9,13H,10H2,1-2H3/q+1 |
| InChIKey | KWNHEIJTZQFMIM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|