C16H17ClN5O3S+ — CID 78213480
2-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide (PubChem CID 78213480) has the molecular formula C16H17ClN5O3S+ and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide.
| Compound Name | 2-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 78213480 |
| Molecular Formula | C16H17ClN5O3S+ |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide |
| SMILES | CN1C(=O)C2C(=NC(SCC(N)=O)=[N+]2Cc2cccc(Cl)c2)N(C)C1=O |
| InChI | InChI=1S/C16H16ClN5O3S/c1-20-13-12(14(24)21(2)16(20)25)22(15(19-13)26-8-11(18)23)7-9-4-3-5-10(17)6-9/h3-6,12H,7-8H2,1-2H3,(H-,18,23)/p+1 |
| InChIKey | DOARZAFXHQILBH-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|