C22H23N4O2S+ — CID 78212612
7-benzyl-1,3-dimethyl-8-[(3-methylphenyl)methylsulfanyl]-5H-purin-7-ium-2,6-dione (PubChem CID 78212612) has the molecular formula C22H23N4O2S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-8-[(3-methylphenyl)methylsulfanyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-benzyl-1,3-dimethyl-8-[(3-methylphenyl)methylsulfanyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78212612 |
| Molecular Formula | C22H23N4O2S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-8-[(3-methylphenyl)methylsulfanyl]-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1cccc(CSC2=[N+](Cc3ccccc3)C3C(=O)N(C)C(=O)N(C)C3=N2)c1 |
| InChI | InChI=1S/C22H23N4O2S/c1-15-8-7-11-17(12-15)14-29-21-23-19-18(20(27)25(3)22(28)24(19)2)26(21)13-16-9-5-4-6-10-16/h4-12,18H,13-14H2,1-3H3/q+1 |
| InChIKey | HTRTUNVDAKVZKR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|