C19H26N5O3+ — CID 78304901
7-benzyl-8-(3-ethoxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78304901) has the molecular formula C19H26N5O3+ and a molecular weight of 372.45 g/mol. Its IUPAC name is 7-benzyl-8-(3-ethoxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-benzyl-8-(3-ethoxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78304901 |
| Molecular Formula | C19H26N5O3+ |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 7-benzyl-8-(3-ethoxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCOCCCNC1=[N+](Cc2ccccc2)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C19H25N5O3/c1-4-27-12-8-11-20-18-21-16-15(17(25)23(3)19(26)22(16)2)24(18)13-14-9-6-5-7-10-14/h5-7,9-10,15H,4,8,11-13H2,1-3H3/p+1 |
| InChIKey | AVAYUEOEAKEWJC-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|