C18H23ClN5O2+ — CID 78212932
8-(butan-2-ylamino)-7-[(2-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78212932) has the molecular formula C18H23ClN5O2+ and a molecular weight of 376.87 g/mol. Its IUPAC name is 8-(butan-2-ylamino)-7-[(2-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(butan-2-ylamino)-7-[(2-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78212932 |
| Molecular Formula | C18H23ClN5O2+ |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 8-(butan-2-ylamino)-7-[(2-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCC(C)NC1=[N+](Cc2ccccc2Cl)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C18H22ClN5O2/c1-5-11(2)20-17-21-15-14(16(25)23(4)18(26)22(15)3)24(17)10-12-8-6-7-9-13(12)19/h6-9,11,14H,5,10H2,1-4H3/p+1 |
| InChIKey | YVOABZBXECXWGZ-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|