C23H25N6O2+ — CID 156590091
1,3-dimethyl-7-[(2-methylphenyl)methyl]-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione (PubChem CID 156590091) has the molecular formula C23H25N6O2+ and a molecular weight of 417.49 g/mol. Its IUPAC name is 1,3-dimethyl-7-[(2-methylphenyl)methyl]-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[(2-methylphenyl)methyl]-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 156590091 |
| Molecular Formula | C23H25N6O2+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 1,3-dimethyl-7-[(2-methylphenyl)methyl]-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1ccc(/C=N/NC2=[N+](Cc3ccccc3C)C3C(=O)N(C)C(=O)N(C)C3=N2)cc1 |
| InChI | InChI=1S/C23H24N6O2/c1-15-9-11-17(12-10-15)13-24-26-22-25-20-19(21(30)28(4)23(31)27(20)3)29(22)14-18-8-6-5-7-16(18)2/h5-13,19H,14H2,1-4H3/p+1/b24-13+ |
| InChIKey | PHZLLENAENDMRD-ZMOGYAJESA-O |
| XLogP | 2.10 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|