C18H20N5O2S2+ — CID 78357519
8-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione (PubChem CID 78357519) has the molecular formula C18H20N5O2S2+ and a molecular weight of 402.53 g/mol. Its IUPAC name is 8-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78357519 |
| Molecular Formula | C18H20N5O2S2+ |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 8-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1ccccc1C[N+]1=C(SC2=NCCS2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H20N5O2S2/c1-11-6-4-5-7-12(11)10-23-13-14(21(2)18(25)22(3)15(13)24)20-16(23)27-17-19-8-9-26-17/h4-7,13H,8-10H2,1-3H3/q+1 |
| InChIKey | CFMDDVTWLOKCKB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|