C26H30FN6O2+ — CID 74722862
8-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione (PubChem CID 74722862) has the molecular formula C26H30FN6O2+ and a molecular weight of 477.56 g/mol. Its IUPAC name is 8-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74722862 |
| Molecular Formula | C26H30FN6O2+ |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 8-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(2-methylphenyl)methyl]-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1ccccc1C[N+]1=C(CN2CCN(c3ccccc3F)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C26H30FN6O2/c1-18-8-4-5-9-19(18)16-33-22(28-24-23(33)25(34)30(3)26(35)29(24)2)17-31-12-14-32(15-13-31)21-11-7-6-10-20(21)27/h4-11,23H,12-17H2,1-3H3/q+1 |
| InChIKey | GQHDLVUOOGAOOS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|