C26H31N6O3+ — CID 74738460
7-benzyl-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74738460) has the molecular formula C26H31N6O3+ and a molecular weight of 475.57 g/mol. Its IUPAC name is 7-benzyl-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-benzyl-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74738460 |
| Molecular Formula | C26H31N6O3+ |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 7-benzyl-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | COc1ccc(N2CCN(CC3=[N+](Cc4ccccc4)C4C(=O)N(C)C(=O)N(C)C4=N3)CC2)cc1 |
| InChI | InChI=1S/C26H31N6O3/c1-28-24-23(25(33)29(2)26(28)34)32(17-19-7-5-4-6-8-19)22(27-24)18-30-13-15-31(16-14-30)20-9-11-21(35-3)12-10-20/h4-12,23H,13-18H2,1-3H3/q+1 |
| InChIKey | LVZVEHIIFSUTMQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|