C23H31N6O4+ — CID 74732338
ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-phenylethyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate (PubChem CID 74732338) has the molecular formula C23H31N6O4+ and a molecular weight of 455.54 g/mol. Its IUPAC name is ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-phenylethyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-phenylethyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74732338 |
| Molecular Formula | C23H31N6O4+ |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-phenylethyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC2=[N+](CCc3ccccc3)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C23H31N6O4/c1-4-33-23(32)28-14-12-27(13-15-28)16-18-24-20-19(21(30)26(3)22(31)25(20)2)29(18)11-10-17-8-6-5-7-9-17/h5-9,19H,4,10-16H2,1-3H3/q+1 |
| InChIKey | SDYZCYKULYIQEP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|