C15H24N7O3+ — CID 74549143
2-[1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide (PubChem CID 74549143) has the molecular formula C15H24N7O3+ and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide.
| Compound Name | 2-[1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
|---|---|
| PubChem CID | 74549143 |
| Molecular Formula | C15H24N7O3+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CN1CCN(CC2=[N+](CC(N)=O)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C15H23N7O3/c1-18-4-6-21(7-5-18)9-11-17-13-12(22(11)8-10(16)23)14(24)20(3)15(25)19(13)2/h12H,4-9H2,1-3H3,(H-,16,23)/p+1 |
| InChIKey | GZHBTDOBFMTECW-UHFFFAOYSA-O |
| XLogP | -2.57 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|