C18H29N6O4+ — CID 78202843
1,3-dimethyl-7-(2-morpholin-4-ylethyl)-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 78202843) has the molecular formula C18H29N6O4+ and a molecular weight of 393.47 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-morpholin-4-ylethyl)-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(2-morpholin-4-ylethyl)-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78202843 |
| Molecular Formula | C18H29N6O4+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1,3-dimethyl-7-(2-morpholin-4-ylethyl)-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(CN3CCOCC3)=[N+]2CCN2CCOCC2)N(C)C1=O |
| InChI | InChI=1S/C18H29N6O4/c1-20-16-15(17(25)21(2)18(20)26)24(4-3-22-5-9-27-10-6-22)14(19-16)13-23-7-11-28-12-8-23/h15H,3-13H2,1-2H3/q+1 |
| InChIKey | CPPBMPFCFGWJDK-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|