C22H31N6O4+ — CID 78203388
7-(2-methoxyethyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78203388) has the molecular formula C22H31N6O4+ and a molecular weight of 443.53 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78203388 |
| Molecular Formula | C22H31N6O4+ |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 7-(2-methoxyethyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | COCC[N+]1=C(CN2CCN(c3ccc(OC)cc3)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C22H31N6O4/c1-24-20-19(21(29)25(2)22(24)30)28(13-14-31-3)18(23-20)15-26-9-11-27(12-10-26)16-5-7-17(32-4)8-6-16/h5-8,19H,9-15H2,1-4H3/q+1 |
| InChIKey | SNUSQBFCJCFNCV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|