C27H31N6O4+ — CID 74730914
8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-phenacyl-5H-purin-7-ium-2,6-dione (PubChem CID 74730914) has the molecular formula C27H31N6O4+ and a molecular weight of 503.58 g/mol. Its IUPAC name is 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-phenacyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-phenacyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74730914 |
| Molecular Formula | C27H31N6O4+ |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-phenacyl-5H-purin-7-ium-2,6-dione |
| SMILES | COc1ccc(N2CCN(CC3=[N+](CC(=O)c4ccccc4)C4C(=O)N(C)C(=O)N(C)C4=N3)CC2)cc1 |
| InChI | InChI=1S/C27H31N6O4/c1-29-25-24(26(35)30(2)27(29)36)33(17-22(34)19-7-5-4-6-8-19)23(28-25)18-31-13-15-32(16-14-31)20-9-11-21(37-3)12-10-20/h4-12,24H,13-18H2,1-3H3/q+1 |
| InChIKey | IRFOLHIWOTWMRZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|