C25H26Cl2FN6O2+ — CID 73282307
7-[(2,6-dichlorophenyl)methyl]-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73282307) has the molecular formula C25H26Cl2FN6O2+ and a molecular weight of 532.43 g/mol. Its IUPAC name is 7-[(2,6-dichlorophenyl)methyl]-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[(2,6-dichlorophenyl)methyl]-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73282307 |
| Molecular Formula | C25H26Cl2FN6O2+ |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 7-[(2,6-dichlorophenyl)methyl]-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(CN3CCN(c4ccc(F)cc4)CC3)=[N+]2Cc2c(Cl)cccc2Cl)N(C)C1=O |
| InChI | InChI=1S/C25H26Cl2FN6O2/c1-30-23-22(24(35)31(2)25(30)36)34(14-18-19(26)4-3-5-20(18)27)21(29-23)15-32-10-12-33(13-11-32)17-8-6-16(28)7-9-17/h3-9,22H,10-15H2,1-2H3/q+1 |
| InChIKey | OGXMCFMQXIMTEY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|