C22H28ClN6O4+ — CID 74742689
ethyl 4-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate (PubChem CID 74742689) has the molecular formula C22H28ClN6O4+ and a molecular weight of 475.96 g/mol. Its IUPAC name is ethyl 4-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74742689 |
| Molecular Formula | C22H28ClN6O4+ |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | ethyl 4-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC2=[N+](Cc3ccccc3Cl)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C22H28ClN6O4/c1-4-33-22(32)28-11-9-27(10-12-28)14-17-24-19-18(20(30)26(3)21(31)25(19)2)29(17)13-15-7-5-6-8-16(15)23/h5-8,18H,4,9-14H2,1-3H3/q+1 |
| InChIKey | UABOTRRTBHXCKI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|