C21H26ClN6O3+ — CID 74740376
1-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide (PubChem CID 74740376) has the molecular formula C21H26ClN6O3+ and a molecular weight of 445.93 g/mol. Its IUPAC name is 1-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74740376 |
| Molecular Formula | C21H26ClN6O3+ |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[[7-[(3-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
| SMILES | CN1C(=O)C2C(=NC(CN3CCC(C(N)=O)CC3)=[N+]2Cc2cccc(Cl)c2)N(C)C1=O |
| InChI | InChI=1S/C21H25ClN6O3/c1-25-19-17(20(30)26(2)21(25)31)28(11-13-4-3-5-15(22)10-13)16(24-19)12-27-8-6-14(7-9-27)18(23)29/h3-5,10,14,17H,6-9,11-12H2,1-2H3,(H-,23,29)/p+1 |
| InChIKey | LFJXUBFYUPDMMT-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|