C23H32ClN6O2+ — CID 74738704
7-butyl-8-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74738704) has the molecular formula C23H32ClN6O2+ and a molecular weight of 460.00 g/mol. Its IUPAC name is 7-butyl-8-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-butyl-8-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74738704 |
| Molecular Formula | C23H32ClN6O2+ |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 7-butyl-8-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCC[N+]1=C(CN2CCN(c3cc(Cl)ccc3C)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C23H32ClN6O2/c1-5-6-9-30-19(25-21-20(30)22(31)27(4)23(32)26(21)3)15-28-10-12-29(13-11-28)18-14-17(24)8-7-16(18)2/h7-8,14,20H,5-6,9-13,15H2,1-4H3/q+1 |
| InChIKey | FORAGXYAWLYHNO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|