C17H20ClN4O3S+ — CID 78202703
7-[(2-chlorophenyl)methyl]-8-(3-hydroxypropylsulfanyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78202703) has the molecular formula C17H20ClN4O3S+ and a molecular weight of 395.89 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-8-(3-hydroxypropylsulfanyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[(2-chlorophenyl)methyl]-8-(3-hydroxypropylsulfanyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78202703 |
| Molecular Formula | C17H20ClN4O3S+ |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-8-(3-hydroxypropylsulfanyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(SCCCO)=[N+]2Cc2ccccc2Cl)N(C)C1=O |
| InChI | InChI=1S/C17H20ClN4O3S/c1-20-14-13(15(24)21(2)17(20)25)22(16(19-14)26-9-5-8-23)10-11-6-3-4-7-12(11)18/h3-4,6-7,13,23H,5,8-10H2,1-2H3/q+1 |
| InChIKey | FCMIRGZWOSBDKD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|