C25H30N5O3+ — CID 74740420
8-[(dibenzylamino)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74740420) has the molecular formula C25H30N5O3+ and a molecular weight of 448.55 g/mol. Its IUPAC name is 8-[(dibenzylamino)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(dibenzylamino)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74740420 |
| Molecular Formula | C25H30N5O3+ |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 8-[(dibenzylamino)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(CN(Cc3ccccc3)Cc3ccccc3)=[N+]2CCCO)N(C)C1=O |
| InChI | InChI=1S/C25H30N5O3/c1-27-23-22(24(32)28(2)25(27)33)30(14-9-15-31)21(26-23)18-29(16-19-10-5-3-6-11-19)17-20-12-7-4-8-13-20/h3-8,10-13,22,31H,9,14-18H2,1-2H3/q+1 |
| InChIKey | YPIICOKUHHVXGD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|