C12H17N4O4+ — CID 75608984
8-(hydroxymethyl)-1,3-dimethyl-7-(3-oxobutyl)-5H-purin-7-ium-2,6-dione (PubChem CID 75608984) has the molecular formula C12H17N4O4+ and a molecular weight of 281.29 g/mol. Its IUPAC name is 8-(hydroxymethyl)-1,3-dimethyl-7-(3-oxobutyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(hydroxymethyl)-1,3-dimethyl-7-(3-oxobutyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608984 |
| Molecular Formula | C12H17N4O4+ |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 8-(hydroxymethyl)-1,3-dimethyl-7-(3-oxobutyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(=O)CC[N+]1=C(CO)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C12H17N4O4/c1-7(18)4-5-16-8(6-17)13-10-9(16)11(19)15(3)12(20)14(10)2/h9,17H,4-6H2,1-3H3/q+1 |
| InChIKey | ZEIZEQUBABOWRN-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|