C10H17N6O4+ — CID 78227579
7-(2,3-dihydroxypropyl)-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78227579) has the molecular formula C10H17N6O4+ and a molecular weight of 285.28 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78227579 |
| Molecular Formula | C10H17N6O4+ |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(NN)=[N+]2CC(O)CO)N(C)C1=O |
| InChI | InChI=1S/C10H16N6O4/c1-14-7-6(8(19)15(2)10(14)20)16(3-5(18)4-17)9(12-7)13-11/h5-6,17-18H,3-4,11H2,1-2H3/p+1 |
| InChIKey | XEGQMMTUMQKXPY-UHFFFAOYSA-O |
| XLogP | -3.52 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|