C18H25N6O4+ — CID 73453182
7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73453182) has the molecular formula C18H25N6O4+ and a molecular weight of 389.44 g/mol. Its IUPAC name is 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73453182 |
| Molecular Formula | C18H25N6O4+ |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-hydrazinyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCc1cccc(OCC(O)C[N+]2=C(NN)N=C3C2C(=O)N(C)C(=O)N3C)c1 |
| InChI | InChI=1S/C18H24N6O4/c1-4-11-6-5-7-13(8-11)28-10-12(25)9-24-14-15(20-17(24)21-19)22(2)18(27)23(3)16(14)26/h5-8,12,14,25H,4,9-10,19H2,1-3H3/p+1 |
| InChIKey | WRXVSCHKRNHSTJ-UHFFFAOYSA-O |
| XLogP | -0.88 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|