C20H25N4O7S+ — CID 73453220
methyl 2-[[7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetate (PubChem CID 73453220) has the molecular formula C20H25N4O7S+ and a molecular weight of 465.51 g/mol. Its IUPAC name is methyl 2-[[7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 73453220 |
| Molecular Formula | C20H25N4O7S+ |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | methyl 2-[[7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSC1=[N+](CC(O)COc2ccc(OC)cc2)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C20H25N4O7S/c1-22-17-16(18(27)23(2)20(22)28)24(19(21-17)32-11-15(26)30-4)9-12(25)10-31-14-7-5-13(29-3)6-8-14/h5-8,12,16,25H,9-11H2,1-4H3/q+1 |
| InChIKey | UEIJKCHTOZQSAP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|