C22H30N5O5+ — CID 78212709
7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione (PubChem CID 78212709) has the molecular formula C22H30N5O5+ and a molecular weight of 444.51 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 78212709 |
| Molecular Formula | C22H30N5O5+ |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione |
| SMILES | COc1ccc(OCC(O)CN2C(=[N+]3CCCCC3)N=C3C2C(=O)N(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C22H30N5O5/c1-24-19-18(20(29)25(2)22(24)30)27(21(23-19)26-11-5-4-6-12-26)13-15(28)14-32-17-9-7-16(31-3)8-10-17/h7-10,15,18,28H,4-6,11-14H2,1-3H3/q+1 |
| InChIKey | NGOWOTZNNHZDTE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|