C16H19BrN4O5 — CID 78202269
8-bromo-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78202269) has the molecular formula C16H19BrN4O5 and a molecular weight of 427.26 g/mol. Its IUPAC name is 8-bromo-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-bromo-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78202269 |
| Molecular Formula | C16H19BrN4O5 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 8-bromo-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | COc1ccc(OCC(O)CN2C(Br)=NC3C2C(=O)NC(=O)N3C)cc1 |
| InChI | InChI=1S/C16H19BrN4O5/c1-20-13-12(14(23)19-16(20)24)21(15(17)18-13)7-9(22)8-26-11-5-3-10(25-2)4-6-11/h3-6,9,12-13,22H,7-8H2,1-2H3,(H,19,23,24) |
| InChIKey | SXYYXBGVUTWJOV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|