C22H29ClN4O6S — CID 74692693
pentyl 2-[[7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]sulfanyl]acetate (PubChem CID 74692693) has the molecular formula C22H29ClN4O6S and a molecular weight of 513.02 g/mol. Its IUPAC name is pentyl 2-[[7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]sulfanyl]acetate.
| Compound Name | pentyl 2-[[7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 74692693 |
| Molecular Formula | C22H29ClN4O6S |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | pentyl 2-[[7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]sulfanyl]acetate |
| SMILES | CCCCCOC(=O)CSC1=NC2C(C(=O)NC(=O)N2C)N1CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29ClN4O6S/c1-3-4-5-10-32-17(29)13-34-22-24-19-18(20(30)25-21(31)26(19)2)27(22)11-15(28)12-33-16-8-6-14(23)7-9-16/h6-9,15,18-19,28H,3-5,10-13H2,1-2H3,(H,25,30,31) |
| InChIKey | QDKGAHZQUACQGS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|