C15H24N4O2S — CID 78304342
3-methyl-8-(2-methylprop-2-enylsulfanyl)-7-pentyl-4,5-dihydropurine-2,6-dione (PubChem CID 78304342) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-methyl-8-(2-methylprop-2-enylsulfanyl)-7-pentyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-8-(2-methylprop-2-enylsulfanyl)-7-pentyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78304342 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-methyl-8-(2-methylprop-2-enylsulfanyl)-7-pentyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=C(C)CSC1=NC2C(C(=O)NC(=O)N2C)N1CCCCC |
| InChI | InChI=1S/C15H24N4O2S/c1-5-6-7-8-19-11-12(16-15(19)22-9-10(2)3)18(4)14(21)17-13(11)20/h11-12H,2,5-9H2,1,3-4H3,(H,17,20,21) |
| InChIKey | NQJWWSWZOSYQOC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|